
CAS 1009119-82-7
:1,2-Pyrrolidinedicarboxylic acid, 2,2′-[[1,1′-biphenyl]-4,4′-diylbis(2-oxo-2,1-ethanediyl)] bis[1-(1,1-dimethylethyl)] ester, (2S)-
Description:
1,2-Pyrrolidinedicarboxylic acid, 2,2′-[[1,1′-biphenyl]-4,4′-diylbis(2-oxo-2,1-ethanediyl)] bis[1-(1,1-dimethylethyl)] ester, with CAS number 1009119-82-7, is a complex organic compound characterized by its multi-functional structure. It features a pyrrolidine ring, which contributes to its cyclic nature and potential for forming hydrogen bonds. The presence of two carboxylic acid groups indicates that it can participate in acid-base reactions and may exhibit solubility in polar solvents. The biphenyl moiety suggests potential for π-π stacking interactions, which can influence its physical properties and reactivity. Additionally, the presence of tert-butyl groups enhances its hydrophobic character, potentially affecting its solubility and interaction with biological systems. This compound may be of interest in various applications, including pharmaceuticals and materials science, due to its unique structural features and potential for functionalization. Overall, its characteristics make it a subject of interest for further research and development in chemical applications.
Formula:C36H44N2O10
InChI:InChI=1S/C36H44N2O10/c1-35(2,3)47-33(43)37-19-7-9-27(37)31(41)45-21-29(39)25-15-11-23(12-16-25)24-13-17-26(18-14-24)30(40)22-46-32(42)28-10-8-20-38(28)34(44)48-36(4,5)6/h11-18,27-28H,7-10,19-22H2,1-6H3/t27-,28-/m0/s1
InChI key:InChIKey=SONAICBCXXXQKU-NSOVKSMOSA-N
SMILES:C(OCC(=O)C1=CC=C(C=C1)C2=CC=C(C(COC(=O)[C@H]3N(C(OC(C)(C)C)=O)CCC3)=O)C=C2)(=O)[C@H]4N(C(OC(C)(C)C)=O)CCC4
Synonyms:- 1,2-Pyrrolidinedicarboxylic acid, 2,2′-[[1,1′-biphenyl]-4,4′-diylbis(2-oxo-2,1-ethanediyl)] bis[1-(1,1-dimethylethyl)] ester, (2S)-
- Daclatasvir intermediate 3
- 1,2-Pyrrolidinedicarboxylic acid, 2,2'-[[1,1'-biphenyl]-4,4'-diylbis(2-oxo-2,1-ethanediyl)] bis[1-(1,1-dimethylethyl)] ester
- O''2,O2-([1,1''-Biphenyl]-4,4''-diylbis(2-oxoethane-2,1-diyl)) 1,1''-di-tert-butyl (2S,2''S)-bis(pyrrolidine-1,2-dicarboxylate)
- AB10587
- 1,2-Pyrrolidinedicarboxy lic acid,2,2'-[[1,1'-biphenyl]-4,4'...
- (2S,2'S)-O'2,O2-([1,1'-biphenyl]-4,4'-diylbis(2-oxoethane-2,1-diyl))1-di-tert-butylbis(pyrrolidine-1,2-dicarboxylate)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
