
CAS 1009120-06-2
:Methyl 2-(methoxycarbonylamino)-2-(oxetan-3-yl)acetate
Description:
Methyl 2-(methoxycarbonylamino)-2-(oxetan-3-yl)acetate, identified by its CAS number 1009120-06-2, is an organic compound characterized by its complex structure, which includes both an oxetane ring and a methoxycarbonylamino group. This compound typically exhibits properties associated with esters, such as being a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. It is likely to be soluble in organic solvents due to the presence of the ester functional group, while its polar methoxycarbonylamino group may impart some degree of hydrophilicity. The oxetane ring contributes to its unique reactivity, potentially allowing for various chemical transformations. Methyl 2-(methoxycarbonylamino)-2-(oxetan-3-yl)acetate may find applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to its structural features that can facilitate further chemical modifications. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C8H13NO5
InChI:InChI=1S/C8H13NO5/c1-12-7(10)6(5-3-14-4-5)9-8(11)13-2/h5-6H,3-4H2,1-2H3,(H,9,11)
InChI key:InChIKey=UNEHOGBDOBZLOA-UHFFFAOYSA-N
SMILES:C(NC(OC)=O)(C(OC)=O)C1COC1
Synonyms:- 3-Oxetaneacetic acid, α-[(methoxycarbonyl)amino]-, methyl ester
- Methyl 2-(methoxycarbonylamino)-2-(oxetan-3-yl)acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.