
CAS 100914-36-1
:6-Nitro-2-(3-nitrophenyl)-4H-1-benzopyran-4-one
Description:
6-Nitro-2-(3-nitrophenyl)-4H-1-benzopyran-4-one, with the CAS number 100914-36-1, is a synthetic organic compound characterized by its complex structure, which includes a benzopyran core substituted with nitro groups and a phenyl ring. This compound typically exhibits a yellow to orange color due to its conjugated system, which allows for the absorption of visible light. It is known for its potential applications in various fields, including pharmaceuticals and materials science, owing to its unique electronic properties and reactivity. The presence of nitro groups contributes to its electron-withdrawing characteristics, which can influence its chemical behavior, such as reactivity in electrophilic aromatic substitution reactions. Additionally, the compound may exhibit fluorescence, making it useful in certain analytical applications. As with many nitro-substituted compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Overall, 6-Nitro-2-(3-nitrophenyl)-4H-1-benzopyran-4-one is a notable compound in organic chemistry with diverse implications in research and industry.
Formula:C15H8N2O6
InChI:InChI=1S/C15H8N2O6/c18-13-8-15(9-2-1-3-10(6-9)16(19)20)23-14-5-4-11(17(21)22)7-12(13)14/h1-8H
InChI key:InChIKey=CNVQMRWAJHEFGZ-UHFFFAOYSA-N
SMILES:O=C1C=2C(OC(=C1)C3=CC(N(=O)=O)=CC=C3)=CC=C(N(=O)=O)C2
Synonyms:- 4H-1-Benzopyran-4-one, 6-nitro-2-(3-nitrophenyl)-
- 6-Nitro-2-(3-nitrophenyl)-4H-1-benzopyran-4-one
- 6,3′-Dinitroflavone
- Flavone, 3′,6-dinitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

