CAS 10092-63-4
:5-FLUORO-8-QUINOLINESULFONIC ACID
Description:
5-Fluoro-8-quinolinesulfonic acid is a chemical compound characterized by its quinoline structure, which features a fluorine atom at the 5-position and a sulfonic acid group at the 8-position. This compound is typically a solid at room temperature and is known for its solubility in polar solvents, which is influenced by the presence of the sulfonic acid group. The sulfonic acid moiety imparts strong acidic properties, making it a useful reagent in various chemical reactions, particularly in organic synthesis and analytical chemistry. The fluorine substitution can enhance the compound's biological activity and influence its interaction with biological systems, making it of interest in pharmaceutical research. Additionally, 5-fluoro-8-quinolinesulfonic acid may exhibit fluorescence, which can be advantageous in applications such as fluorescence microscopy or as a fluorescent probe in biochemical assays. Safety data indicates that, like many chemical substances, it should be handled with care, using appropriate safety measures to avoid exposure.
Formula:C9H6FNO3S
InChI:InChI=1/C9H6FNO3S/c10-7-3-4-8(15(12,13)14)9-6(7)2-1-5-11-9/h1-5H,(H,12,13,14)
SMILES:c1cc2c(ccc(c2nc1)S(=O)(=O)O)F
Synonyms:- 5-Fluoroquinoline-8-Sulfonic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
