
CAS 100922-97-2
:1-Methyl-1H-indazol-3-ol
Description:
1-Methyl-1H-indazol-3-ol, with the CAS number 100922-97-2, is a chemical compound characterized by its indazole structure, which consists of a five-membered ring containing two nitrogen atoms. This compound features a hydroxyl group (-OH) at the 3-position and a methyl group (-CH3) at the 1-position of the indazole ring. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the hydroxyl group. The compound is of interest in various fields, including medicinal chemistry, due to its potential biological activities. Its structure allows for various interactions with biological targets, making it a candidate for further research in drug development. Additionally, 1-Methyl-1H-indazol-3-ol may undergo typical organic reactions, such as substitution and oxidation, which can be exploited in synthetic chemistry. Safety data and handling precautions should be observed, as with any chemical substance, to ensure safe laboratory practices.
Formula:C8H8N2O
InChI:InChI=1S/C8H8N2O/c1-10-7-5-3-2-4-6(7)8(11)9-10/h2-5H,1H3,(H,9,11)
InChI key:InChIKey=ONNIFDMRZCMQQM-UHFFFAOYSA-N
SMILES:OC=1C=2C(N(C)N1)=CC=CC2
Synonyms:- 1H-Indazol-3-ol, 1-methyl-
- 1-Methyl-1H-indazol-3-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
