CymitQuimica logo

CAS 100924-68-3

:

2-[(1H-Benzimidazol-2-ylsulfinyl)methyl]-N,N-dimethylbenzenamine

Description:
2-[(1H-Benzimidazol-2-ylsulfinyl)methyl]-N,N-dimethylbenzenamine, with the CAS number 100924-68-3, is a chemical compound characterized by its complex structure, which includes a benzimidazole moiety and a sulfinyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The benzimidazole ring is known for its biological activity, often contributing to pharmacological properties, while the sulfinyl group may enhance its stability and reactivity. The dimethylamino group can influence the compound's basicity and interaction with biological targets. Overall, this substance may be of interest in medicinal chemistry and drug development, particularly for its potential applications in treating various diseases. Its specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or detailed literature references for precise values.
Formula:C16H17N3OS
InChI:InChI=1S/C16H17N3OS/c1-19(2)15-10-6-3-7-12(15)11-21(20)16-17-13-8-4-5-9-14(13)18-16/h3-10H,11H2,1-2H3,(H,17,18)
InChI key:InChIKey=JVIHSTYYPRUSFG-UHFFFAOYSA-N
SMILES:S(CC1=C(N(C)C)C=CC=C1)(=O)C=2NC=3C(N2)=CC=CC3
Synonyms:
  • Benzenamine, 2-[(1H-benzimidazol-2-ylsulfinyl)methyl]-N,N-dimethyl-
  • 2-((2-Dimethylaminobenzyl)sulfinyl)benzimidazole
  • NC 1300
  • 2-[(1H-Benzimidazol-2-ylsulfinyl)methyl]-N,N-dimethylbenzenamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.