
CAS 1009260-28-9
:1,2,3,4-Tetrahydro-2-[[2-(trifluoromethyl)phenyl]sulfonyl]-3-isoquinolinecarboxylic acid
Description:
1,2,3,4-Tetrahydro-2-[[2-(trifluoromethyl)phenyl]sulfonyl]-3-isoquinolinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a tetrahydroisoquinoline core and a sulfonyl group attached to a trifluoromethyl-substituted phenyl ring. This compound typically exhibits properties associated with both its isoquinoline and sulfonyl functionalities, such as potential biological activity and solubility characteristics influenced by the presence of the trifluoromethyl group. The sulfonyl moiety can enhance the compound's reactivity and may contribute to its pharmacological properties, making it of interest in medicinal chemistry. Additionally, the trifluoromethyl group is known to increase lipophilicity, which can affect the compound's absorption and distribution in biological systems. Overall, this compound may be explored for its potential applications in drug development, particularly in areas targeting specific biological pathways or conditions. However, detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C17H14F3NO4S
InChI:InChI=1S/C17H14F3NO4S/c18-17(19,20)13-7-3-4-8-15(13)26(24,25)21-10-12-6-2-1-5-11(12)9-14(21)16(22)23/h1-8,14H,9-10H2,(H,22,23)
InChI key:InChIKey=FDCARSJLJIFTCB-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C(C(O)=O)CC=2C(C1)=CC=CC2)C3=C(C(F)(F)F)C=CC=C3
Synonyms:- 3-Isoquinolinecarboxylic acid, 1,2,3,4-tetrahydro-2-[[2-(trifluoromethyl)phenyl]sulfonyl]-
- 1,2,3,4-Tetrahydro-2-[[2-(trifluoromethyl)phenyl]sulfonyl]-3-isoquinolinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.