CAS 1009368-29-9

3-Azetidinol, 3-(N-methylcarbamate), hydrochloride (1:1)

Description:

3-Azetidinol, 3-(N-methylcarbamate), hydrochloride (1:1) is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. This compound features a carbamate functional group, which is derived from the reaction of an amine with a carbonic acid derivative, specifically N-methylcarbamate in this case. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and stability. Typically, such compounds may exhibit biological activity, potentially serving as intermediates in pharmaceutical synthesis or as active pharmaceutical ingredients. The presence of the azetidine ring may contribute to unique pharmacological properties, including potential interactions with biological targets. As with many chemical substances, safety data sheets and handling guidelines should be consulted to ensure proper handling and usage, given the potential for toxicity or reactivity associated with nitrogen-containing heterocycles and carbamate derivatives.

Formula: C₅H₁₀N₂O₂·ClH

InChI: InChI=1S/C5H10N2O2.ClH/c1-6-5(8)9-4-2-7-3-4;/h4,7H,2-3H2,1H3,(H,6,8);1H

InChI key: InChIKey=ZUIWRPYQXZEDEM-UHFFFAOYSA-N

SMILES: O(C(NC)=O)C1CNC1.Cl

Synonyms:

• 3-Azetidinol, 3-(N-methylcarbamate), hydrochloride (1:1)

Azetidin-3-yl N-methylcarbamate hydrochloride

CAS: 1009368-29-9

Versatile small molecule scaffold

Formula: C₅H₁₁ClN₂O₂

Purity: Min. 95%

Molecular weight: 166.6 g/mol

Ref: 3D-JQB36829