CAS 1009376-55-9

3-Piperidinecarboxylic acid, 4-methyl-, methyl ester, hydrochloride (1:1), (3R,4S)-rel-

Description:

3-Piperidinecarboxylic acid, 4-methyl-, methyl ester, hydrochloride (1:1), (3R,4S)-rel- is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a carboxylic acid functional group and a methyl ester, indicating it has both acidic and ester functionalities. The presence of the hydrochloride indicates that it is a salt formed with hydrochloric acid, which enhances its solubility in water and may influence its pharmacological properties. The stereochemistry is specified as (3R,4S), indicating the specific three-dimensional arrangement of atoms around the chiral centers, which can significantly affect the compound's biological activity and interactions. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity associated with piperidine derivatives. Its CAS number, 1009376-55-9, uniquely identifies it in chemical databases, facilitating research and regulatory processes.

Formula: C₈H₁₅NO₂·ClH

InChI: InChI=1/C8H15NO2.ClH/c1-6-3-4-9-5-7(6)8(10)11-2;/h6-7,9H,3-5H2,1-2H3;1H/t6-,7-;/s2

InChI key: InChIKey=QATUSYOQNXADOL-NSLAZIKQNA-N

SMILES: C(OC)(=O)[C@@H]1[C@@H](C)CCNC1.Cl

Synonyms:

• 3-Piperidinecarboxylic acid, 4-methyl-, methyl ester, hydrochloride (1:1), (3R,4S)-rel-