CAS 1009377-11-0

3-Piperidinecarboxylic acid, 6-methyl-, methyl ester, hydrochloride (1:1), (3R,6R)-

Description:

3-Piperidinecarboxylic acid, 6-methyl-, methyl ester, hydrochloride (1:1), (3R,6R)- is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. The compound features a carboxylic acid functional group that is esterified with a methyl group, indicating it is a methyl ester. The presence of the hydrochloride indicates that the compound is in its salt form, which enhances its solubility in water and may influence its biological activity. The stereochemistry is specified as (3R,6R), indicating the specific three-dimensional arrangement of atoms around the chiral centers at positions 3 and 6 of the piperidine ring. This stereochemistry can significantly affect the compound's pharmacological properties and interactions with biological targets. Overall, this compound may be of interest in medicinal chemistry and pharmacology due to its potential applications in drug development, particularly in the context of neuroactive compounds or as intermediates in synthetic pathways.

Formula: C₈H₁₅NO₂·ClH

InChI: InChI=1S/C8H15NO2.ClH/c1-6-3-4-7(5-9-6)8(10)11-2;/h6-7,9H,3-5H2,1-2H3;1H/t6-,7-;/m1./s1

InChI key: InChIKey=COCIOCKRYRXGEP-ZJLYAJKPSA-N

SMILES: C(OC)(=O)[C@@H]1CC[C@@H](C)NC1.Cl

Synonyms:

• 3-Piperidinecarboxylic acid, 6-methyl-, methyl ester, hydrochloride (1:1), (3R,6R)-