CymitQuimica logo

CAS 100951-55-1

:

N-[cyano(phenyl)methyl]-N~2~,N~2~-diethylalaninamide

Description:
N-[cyano(phenyl)methyl]-N2,N2-diethylalaninamide, with the CAS number 100951-55-1, is a synthetic organic compound characterized by its unique structural features. It contains an alanine backbone, which is an amino acid, modified with diethyl groups and a cyano(phenyl)methyl substituent. This compound is likely to exhibit properties typical of amides, such as moderate solubility in polar solvents and potential reactivity due to the presence of the cyano group, which can participate in nucleophilic reactions. The phenyl group contributes to the compound's hydrophobic character, influencing its overall solubility and interaction with biological systems. Additionally, the presence of the cyano group may impart specific biological activities or pharmacological properties, making it of interest in medicinal chemistry. As with many synthetic compounds, safety and handling precautions are essential, as they may pose risks depending on their reactivity and toxicity profiles. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including pharmaceuticals and materials science.
Formula:C15H21N3O
InChI:InChI=1/C15H21N3O/c1-4-18(5-2)12(3)15(19)17-14(11-16)13-9-7-6-8-10-13/h6-10,12,14H,4-5H2,1-3H3,(H,17,19)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.