
CAS 1009529-98-9
:1-[[4-(1,1-Dimethylethyl)phenyl]sulfonyl]-4-hydroxyproline
Description:
1-[[4-(1,1-Dimethylethyl)phenyl]sulfonyl]-4-hydroxyproline, identified by its CAS number 1009529-98-9, is a chemical compound that features a proline derivative with a sulfonyl group attached to a substituted phenyl ring. This compound is characterized by its unique structural features, including a bulky tert-butyl group, which can influence its solubility and reactivity. The presence of the sulfonyl group typically enhances the compound's polarity, potentially affecting its interactions in biological systems. Additionally, the hydroxyl group on the proline moiety may participate in hydrogen bonding, contributing to its stability and reactivity. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific pathways or conditions. Its synthesis and characterization would involve standard organic chemistry techniques, and its properties can be further explored through various analytical methods such as NMR, IR spectroscopy, and mass spectrometry.
Formula:C15H21NO5S
InChI:InChI=1S/C15H21NO5S/c1-15(2,3)10-4-6-12(7-5-10)22(20,21)16-9-11(17)8-13(16)14(18)19/h4-7,11,13,17H,8-9H2,1-3H3,(H,18,19)
InChI key:InChIKey=LHWUEWUYTCXHHH-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C(C(O)=O)CC(O)C1)C2=CC=C(C(C)(C)C)C=C2
Synonyms:- Proline, 1-[[4-(1,1-dimethylethyl)phenyl]sulfonyl]-4-hydroxy-
- 1-[[4-(1,1-Dimethylethyl)phenyl]sulfonyl]-4-hydroxyproline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.