CAS 100954-50-5

[2-(4-bromobenzoyl)phenyl] acetate

Description:

[2-(4-bromobenzoyl)phenyl] acetate, with the CAS number 100954-50-5, is an organic compound characterized by its aromatic structure and the presence of both an acetate and a bromobenzoyl functional group. This compound features a phenyl ring substituted with a 4-bromobenzoyl group, which contributes to its reactivity and potential applications in organic synthesis. The acetate moiety indicates that it is an ester, which typically enhances solubility in organic solvents and may influence its reactivity in various chemical reactions, such as nucleophilic substitutions or hydrolysis. The presence of the bromine atom can also impart unique electronic properties, potentially making the compound useful in medicinal chemistry or as an intermediate in the synthesis of more complex molecules. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would be influenced by its molecular structure and the interactions between its functional groups. Overall, [2-(4-bromobenzoyl)phenyl] acetate is a versatile compound with potential applications in various fields of chemistry.

Formula: C₁₅H₁₁BrO₃

InChI: InChI=1/C15H11BrO3/c1-10(17)19-14-5-3-2-4-13(14)15(18)11-6-8-12(16)9-7-11/h2-9H,1H3

SMILES: CC(=O)Oc1ccccc1C(=O)c1ccc(cc1)Br

2-Acetoxy-4'-bromobenzophenone

CAS: 100954-50-5

Formula: C₁₅H₁₁BrO₃

Molecular weight: 319.15

Ref: IN-DA0003AX