
CAS 100959-30-6
:4-(Hydroxymethyl)benzaldehyde oxime
Description:
4-(Hydroxymethyl)benzaldehyde oxime, with the CAS number 100959-30-6, is an organic compound characterized by the presence of both an aldehyde and an oxime functional group. It features a benzene ring substituted with a hydroxymethyl group and an oxime group, which is derived from the reaction of an aldehyde with hydroxylamine. This compound typically appears as a solid or crystalline substance and is soluble in polar organic solvents. Its chemical structure allows for potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The oxime functionality can participate in various chemical reactions, including rearrangements and condensation reactions, making it a versatile intermediate in synthetic chemistry. Additionally, the presence of the hydroxymethyl group may enhance its reactivity and solubility properties. As with many organic compounds, safety precautions should be observed when handling it, as it may pose health risks if ingested or inhaled.
Formula:C8H9NO2
InChI:InChI=1S/C8H9NO2/c10-6-8-3-1-7(2-4-8)5-9-11/h1-5,10-11H,6H2
InChI key:InChIKey=DTMHHXCNEAGIRG-UHFFFAOYSA-N
SMILES:C(=NO)C1=CC=C(CO)C=C1
Synonyms:- Benzaldehyde, 4-(hydroxymethyl)-, oxime
- 4-(Hydroxymethyl)benzaldehyde oxime
- p-Tolualdehyde, α-hydroxy-, oxime
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
