CAS 100960-03-0

1,2-Dihydro-2-oxo-3-pyridineacetic acid

Description:

1,2-Dihydro-2-oxo-3-pyridineacetic acid, with the CAS number 100960-03-0, is a chemical compound that features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound is characterized by its dihydro structure, indicating the presence of two hydrogen atoms that contribute to its saturation. The "2-oxo" designation refers to a carbonyl group (C=O) attached to the second carbon of the pyridine ring, while the "3-pyridineacetic acid" portion indicates that it has an acetic acid functional group at the third position relative to the nitrogen atom. This compound is typically studied for its potential biological activities and applications in medicinal chemistry, particularly due to the presence of both the pyridine and carboxylic acid functionalities, which can influence its reactivity and interaction with biological targets. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature, making it a subject of interest in various chemical and pharmaceutical research contexts.

Formula: C₇H₇NO₃

InChI: InChI=1S/C7H7NO3/c9-6(10)4-5-2-1-3-8-7(5)11/h1-3H,4H2,(H,8,11)(H,9,10)

InChI key: InChIKey=FYASBBZWSBMUNJ-UHFFFAOYSA-N

SMILES: C(C(O)=O)C=1C(=O)NC=CC1

Synonyms:

• 3-Pyridineacetic acid, 1,2-dihydro-2-oxo-
• 3-Pyridineacetic acid, 2-hydroxy-
• 2-(2-Hydroxypyridin-3-yl)acetic acid
• (2-Hydroxy-3-pyridinyl)acetic acid
• 1,2-Dihydro-2-oxo-3-pyridineacetic acid

2-(2-Oxo-1,2-dihydropyridin-3-yl)acetic acid

CAS: 100960-03-0

Versatile small molecule scaffold

Formula: C₇H₇NO₃

Purity: Min. 95%

Molecular weight: 153.14 g/mol

Ref: 3D-AEA96003