CAS 100960-07-4

1H-Pyrrolo[2,3-B]pyridin-5-ylamine

Description:

1H-Pyrrolo[2,3-B]pyridin-5-ylamine, with the CAS number 100960-07-4, is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings. This compound features an amine functional group, which contributes to its reactivity and potential applications in medicinal chemistry. The presence of nitrogen atoms in its structure enhances its ability to participate in hydrogen bonding and can influence its solubility and stability in various solvents. Typically, compounds of this nature exhibit biological activity, making them of interest in drug discovery and development. The molecular structure allows for potential interactions with biological targets, which can lead to therapeutic effects. Additionally, the compound may exhibit properties such as fluorescence or photostability, depending on its specific electronic configuration. Its synthesis and characterization are essential for understanding its reactivity and potential applications in pharmaceuticals or agrochemicals. Overall, 1H-Pyrrolo[2,3-B]pyridin-5-ylamine represents a valuable scaffold in the exploration of new chemical entities.

Formula: C₇H₇N₃

InChI: InChI=1/C7H7N3/c8-6-3-5-1-2-9-7(5)10-4-6/h1-4H,8H2,(H,9,10)

SMILES: c1cnc2c1cc(c[nH]2)N

Synonyms:

• 5-Amino-7-Azaindole
• 1H-Pyrrolo[2,3-B]pyridin-5-Amine
• 1H-Pyrrolo[2,3-B]pyridine-5-Amine
• 1H-Pyrrolo[2,3-b]pyridine,5-amino-

5-Amino-7-azaindole

CAS: 100960-07-4

Formula: C₇H₇N₃

Purity: 97%

Color and Shape: Liquid

Molecular weight: 133.1506

Ref: IN-DA0003BO

1H-Pyrrolo[2,3-b]pyridin-5-amine

CAS: 100960-07-4

1H-Pyrrolo[2,3-b]pyridin-5-amine

Purity: 97%

Molecular weight: 133.15g/mol

Ref: 54-OR308039

5-Amino-7-azaindole

CAS: 100960-07-4

Formula: C₇H₇N₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 133.154

Ref: 10-F079965

1H-Pyrrolo[2,3-b]pyridin-5-ylamine

CAS: 100960-07-4

1H-Pyrrolo[2,3-b]pyridin-5-ylamine is a heterocycle that can be synthesized by cyclization of pyrrole with an alkyne. The microwave irradiation of the reaction mixture leads to selective formation of 1-(2-hydroxyphenyl)pyrrolo[2,3-b]pyridine. This heterocycle can be used in the synthesis of other heterocycles and pharmaceuticals.

Purity: Min. 95%

Ref: 3D-FP143125