CymitQuimica logo

CAS 100961-61-3

:

2-[(1,3-BENZOTHIAZOL-2-YLTHIO)METHYL]BENZOIC ACID

Description:
2-[(1,3-Benzothiazol-2-ylthio)methyl]benzoic acid, with the CAS number 100961-61-3, is a chemical compound characterized by its unique structural features that include a benzothiazole moiety and a benzoic acid functional group. This compound typically exhibits properties associated with both aromatic systems, such as stability and potential for π-π interactions. The presence of the thioether linkage contributes to its reactivity and solubility characteristics, which can be influenced by the functional groups attached to the benzene rings. It may display biological activity, making it of interest in pharmaceutical research, particularly in the development of new drugs or as a biochemical probe. The compound's solubility in organic solvents and its potential for forming hydrogen bonds can affect its interactions in various chemical environments. Additionally, its molecular structure suggests potential applications in materials science, particularly in the development of organic semiconductors or as a ligand in coordination chemistry. Overall, this compound represents a versatile structure with implications in both medicinal and materials chemistry.
Formula:C15H10NO2S2
InChI:InChI=1/C15H11NO2S2/c17-14(18)11-6-2-1-5-10(11)9-19-15-16-12-7-3-4-8-13(12)20-15/h1-8H,9H2,(H,17,18)/p-1
InChI key:YMLKRZCJZALYNQ-UHFFFAOYSA-N
SMILES:C1=CC=C(C(=C1)CSC2=NC3=CC=CC=C3S2)C(=O)O
Synonyms:
  • 2-[(1,3-benzothiazol-2-ylsulfanyl)methyl]benzoic acid
  • 2-[(1,3-benzothiazol-2-ylsulfanyl)methyl]benzoate
  • 2-[(1,3-benzothiazol-2-ylthio)methyl]benzoic acid
  • benzoic acid, 2-[(2-benzothiazolylthio)methyl]-
Found 2 products.