CymitQuimica logo

CAS 10097-03-7

:

2,2-Bis(hydroxymethyl)pentanoic acid

Description:
2,2-Bis(hydroxymethyl)pentanoic acid, commonly referred to as DMPA (dimethylol propionic acid), is a chemical compound characterized by its structure, which includes two hydroxymethyl groups attached to a pentanoic acid backbone. This compound is a white crystalline solid at room temperature and is soluble in water due to the presence of the carboxylic acid and hydroxymethyl functional groups. DMPA is primarily used as a building block in the synthesis of polyurethanes and other polymers, where it acts as a chain extender or crosslinking agent. Its ability to enhance water solubility makes it particularly valuable in formulating waterborne coatings and adhesives. Additionally, DMPA exhibits low toxicity and is considered environmentally friendly, which aligns with the growing demand for sustainable chemical products. The compound's reactivity allows it to participate in various chemical reactions, making it versatile in industrial applications. Overall, 2,2-Bis(hydroxymethyl)pentanoic acid is an important compound in polymer chemistry with significant utility in various formulations.
Formula:C7H14O4
InChI:InChI=1S/C7H14O4/c1-2-3-7(4-8,5-9)6(10)11/h8-9H,2-5H2,1H3,(H,10,11)
InChI key:InChIKey=UHAMPPWFPNXLIU-UHFFFAOYSA-N
SMILES:C(CCC)(C(O)=O)(CO)CO
Synonyms:
  • 2,2-Dimethylolvaleric acid
  • Valeric acid, 2,2-bis(hydroxymethyl)-
  • Pentanoic acid, 2,2-bis(hydroxymethyl)-
  • 2,2-Bis(hydroxymethyl)pentanoic acid
  • 2,2-Dimethylolpentanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.