CymitQuimica logo

CAS 1009826-97-4

:

Methyl 5-chloropyrimido[4,5-c]quinoline-8-carboxylate

Description:
Methyl 5-chloropyrimido[4,5-c]quinoline-8-carboxylate is a chemical compound characterized by its complex structure, which includes a pyrimidine ring fused to a quinoline moiety. This compound features a carboxylate functional group, which contributes to its potential reactivity and solubility properties. The presence of a chlorine atom at the 5-position of the pyrimidine ring can influence its electronic properties and biological activity. Methyl esters, like the one in this compound, are often used in organic synthesis and can serve as intermediates in the preparation of various pharmaceuticals and agrochemicals. The compound's unique structure may impart specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, its molecular characteristics, such as melting point, boiling point, and solubility, would be essential for understanding its behavior in different environments and applications. Overall, Methyl 5-chloropyrimido[4,5-c]quinoline-8-carboxylate represents a valuable compound in the field of organic chemistry and drug development.
Formula:C13H8ClN3O2
InChI:InChI=1S/C13H8ClN3O2/c1-19-13(18)7-2-3-8-9-5-15-6-16-11(9)12(14)17-10(8)4-7/h2-6H,1H3
InChI key:InChIKey=XSFXZXTUFUCVCQ-UHFFFAOYSA-N
SMILES:ClC1=C2C(=C3C(C=C(C(OC)=O)C=C3)=N1)C=NC=N2
Synonyms:
  • Methyl 5-chloropyrimido[4,5-c]quinoline-8-carboxylate
  • Pyrimido[4,5-c]quinoline-8-carboxylic acid, 5-chloro-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.