
CAS 100983-91-3
:2-[[5-Amino-2-[(2-hydroxyethyl)amino]phenyl]sulfonyl]ethanol
Description:
2-[[5-Amino-2-[(2-hydroxyethyl)amino]phenyl]sulfonyl]ethanol, with the CAS number 100983-91-3, is a chemical compound characterized by its sulfonamide structure, which typically imparts certain biological activities. This compound features an amino group, a sulfonyl moiety, and a hydroxyl group, suggesting potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the hydroxyethylamino group indicates that it may exhibit solubility in polar solvents, enhancing its bioavailability. Additionally, the amino and hydroxyl functionalities may contribute to hydrogen bonding, influencing its interaction with biological targets. The sulfonamide group is known for its role in various therapeutic agents, particularly as antibacterial agents. Overall, this compound's unique structural features suggest it may possess interesting pharmacological properties, warranting further investigation in drug development and related fields.
Formula:C10H16N2O4S
InChI:InChI=1S/C10H16N2O4S/c11-8-1-2-9(12-3-4-13)10(7-8)17(15,16)6-5-14/h1-2,7,12-14H,3-6,11H2
InChI key:InChIKey=TZXNFIROZWDBSY-UHFFFAOYSA-N
SMILES:S(CCO)(=O)(=O)C1=C(NCCO)C=CC(N)=C1
Synonyms:- Ethanol, 2-[[5-amino-2-[(2-hydroxyethyl)amino]phenyl]sulfonyl]-
- 2-[4-Amino-2-(2-hydroxyethylsulfonyl)anilino]ethanol
- 2-[[5-Amino-2-[(2-hydroxyethyl)amino]phenyl]sulfonyl]ethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ethanol, 2-[[5-amino-2-[(2-hydroxyethyl)amino]phenyl]sulfonyl]-
CAS:Formula:C10H16N2O4SMolecular weight:260.31
