CymitQuimica logo

CAS 100991-90-0

:

1,3-Butanediol, 1-(p-fluorophenyl)-2-methyl-4,4,4-trifluoro-3-(trifluo romethyl)-, 3,4-dichlorocarbanilate

Description:
1,3-Butanediol, 1-(p-fluorophenyl)-2-methyl-4,4,4-trifluoro-3-(trifluoromethyl)-, 3,4-dichlorocarbanilate, with CAS number 100991-90-0, is a complex organic compound characterized by its multifunctional structure. It contains a butanediol backbone, which contributes to its solubility and reactivity. The presence of multiple fluorine atoms imparts unique properties, such as increased lipophilicity and thermal stability, while the dichlorocarbanilate moiety suggests potential applications in agrochemicals or pharmaceuticals. This compound may exhibit significant biological activity due to its structural features, making it of interest in medicinal chemistry. Its synthesis typically involves multi-step reactions, highlighting the importance of careful handling and characterization to ensure purity and efficacy. As with many fluorinated compounds, it may also possess distinct environmental and toxicological profiles, necessitating thorough assessment during its application and disposal. Overall, this compound exemplifies the intricate interplay of functional groups in determining the chemical behavior and potential applications of organic molecules.
Formula:C19H14Cl2F7NO3
InChI:InChI=1/C19H14Cl2F7NO3/c1-9(15(30)10-2-4-11(22)5-3-10)17(18(23,24)25,19(26,27)28)32-16(31)29-12-6-7-13(20)14(21)8-12/h2-9,15,30H,1H3,(H,29,31)
SMILES:CC(C(c1ccc(cc1)F)O)C(C(F)(F)F)(C(F)(F)F)OC(=Nc1ccc(c(c1)Cl)Cl)O
Synonyms:
  • 1,3-Butanediol, 1-(p-fluorophenyl)-2-methyl-4,4,4-trifluoro-3-(trifluoromethyl)-, 3,4-dichlorocarbanilate
  • 1,1,1-Trifluoro-4-(4-Fluorophenyl)-4-Hydroxy-3-Methyl-2-(Trifluoromethyl)Butan-2-Yl (3,4-Dichlorophenyl)Carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.