CAS 100999-26-6
:CY 208-243
Description:
CY 208-243, identified by its CAS number 100999-26-6, is a chemical compound that belongs to a class of substances known for their applications in various industrial processes, particularly in the field of polymer chemistry. This compound is typically characterized by its specific molecular structure, which influences its physical and chemical properties, such as solubility, stability, and reactivity. It may exhibit properties like being a colorless to pale yellow liquid, with a moderate boiling point and a relatively low vapor pressure, making it suitable for use in formulations requiring stability under heat. Additionally, CY 208-243 may have functional groups that allow it to participate in chemical reactions, such as polymerization or cross-linking, which are essential in the production of coatings, adhesives, and other materials. Safety data sheets would provide further details on its handling, toxicity, and environmental impact, which are crucial for ensuring safe usage in industrial applications.
Formula:C19H18N2
InChI:InChI=1S/C19H18N2/c1-21-11-12-5-2-3-6-14(12)19-15-7-4-8-16-18(15)13(10-20-16)9-17(19)21/h2-8,10,17,19-20H,9,11H2,1H3/t17-,19-/m1/s1
InChI key:InChIKey=WRNKIDLXXXIELU-IEBWSBKVSA-N
SMILES:CN1[C@]2([C@@](C=3C=4C(C2)=CNC4C=CC3)(C=5C(C1)=CC=CC5)[H])[H]
Synonyms:- (-)-(6Ar,12Br)-4,6,6A,7,8,12B-Hexahydro-7-Methylindolo[4,3-A]Phenanthridin
- (6aR,12bR)-4,6,6a,7,8,12b-Hexahydro-7-methylindolo[4,3-ab]phenanthridine
- (6aR,12bR)-7-methyl-4,6,6a,7,8,12b-hexahydroindolo[4,3-ab]phenanthridine
- Indolo[4,3-ab]phenanthridine, 4,6,6a,7,8,12b-hexahydro-7-methyl-, (6aR,12bR)-
- Indolo[4,3-ab]phenanthridine, 4,6,6a,7,8,12b-hexahydro-7-methyl-, (6aR-trans)-
- Indolophenanthridine
- CY 208-243
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
CY 208-243
CAS:CY 208-243 is a selective dopamine D2 receptor agonist that has been shown to produce dose-dependent effects in animal models of Parkinson's disease. It is also an inhibitor of uptake of dopamine and cholinergic neurotransmitters. The drug binds to the agonist binding site on the dopamine D2 receptor, which inhibits the inhibitory effect on dopamine release and increases blood pressure. CY 208-243 has been tested in animals and found to have no effect on cognitive function or locomotor activity.Formula:C19H18N2Purity:Min. 95%Molecular weight:274.36 g/molCY 208-243
CAS:CY 208-243 is a selective dopamine D1 receptor agonist with anti-Parkinson disease activity.Formula:C19H18N2Purity:98%Color and Shape:SolidMolecular weight:274.36Ref: 4Z-C-430001
Discontinued product


