CAS 101-06-4
:2-[Bis(phenylmethyl)amino]ethanol
Description:
2-[Bis(phenylmethyl)amino]ethanol, with the CAS number 101-06-4, is an organic compound characterized by its amine and alcohol functional groups. It features a central ethanol backbone with two phenylmethyl groups attached to a nitrogen atom, which contributes to its unique properties. This compound is typically a colorless to pale yellow liquid and is known for its moderate solubility in organic solvents, while being less soluble in water due to the hydrophobic nature of the phenyl groups. It exhibits basicity due to the presence of the amine group, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, 2-[Bis(phenylmethyl)amino]ethanol can act as a ligand in coordination chemistry and may have applications in pharmaceuticals and organic synthesis. Its structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry. However, safety data should be consulted for handling and exposure risks, as with any chemical substance.
Formula:C16H19NO
InChI:InChI=1S/C16H19NO/c18-12-11-17(13-15-7-3-1-4-8-15)14-16-9-5-2-6-10-16/h1-10,18H,11-14H2
InChI key:InChIKey=WTTWSMJHJFNCQB-UHFFFAOYSA-N
SMILES:N(CC1=CC=CC=C1)(CC2=CC=CC=C2)CCO
Synonyms:- 2-(Bis(Phenylmethyl)Amino)-Ethano
- 2-(Bis(Phenylmethyl)Amino)Ethanol
- 2-(Dibenzylamino)-Ethano
- 2-(Dibenzylamino)Ethanol
- 2-(Dibenzylamino)ethan-1-ol
- Dbzela
- Ethanol, 2-(dibenzylamino)-
- Ethanol, 2-[bis(phenylmethyl)amino]-
- N,N-Dibenzyl-2-Aminoethanol
- N,N-Dibenzyl-β-aminoethanol
- N,N-Dibenzylaminoethanol
- N,N-Dibenzylethanolamine
- N-(2-Hydroxyethyl)Dibenzylamine
- d01
- β-(N,N-Dibenzylamino)ethanol
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ethanol, 2-[bis(phenylmethyl)amino]-
CAS:Formula:C16H19NOPurity:98%Color and Shape:SolidMolecular weight:241.3282N,N-Dibenzyl-2-aminoethanol
CAS:Formula:C16H19NOPurity:>98.0%(T)Color and Shape:White or Colorless to Light yellow powder to lump to clear liquidMolecular weight:241.33N,N-Dibenzyl-2-aminoethanol
CAS:Formula:C16H19NOPurity:95%Color and Shape:CrystallineMolecular weight:241.334N,N-Dibenzylethanolamine
CAS:<p>Dibenzylethanolamine is a molecule with the molecular formula C17H26O2. It is a dibasic amine, meaning it has two hydroxyl groups. Dibenzylethanolamine has a specific chemical structure that consists of an alcohol group and two amine groups. The hydrogen atoms on the oxygen atoms in the hydroxyl group are replaced by methyl groups. This component is also used as a solvent for organic solutions, such as paints and varnishes.</p>Formula:C16H19NOPurity:Min. 95%Molecular weight:241.34 g/mol




