
CAS 101-07-5
:Bis(2-ethylhexyl)aminoethanol
Description:
Bis(2-ethylhexyl)aminoethanol, with the CAS number 101-07-5, is an organic compound characterized by its dual alkyl chain structure and amino alcohol functionality. It features two 2-ethylhexyl groups attached to an aminoethanol backbone, which contributes to its amphiphilic nature, allowing it to interact with both polar and non-polar environments. This compound is typically a viscous liquid at room temperature and is known for its surfactant properties, making it useful in various applications, including as a dispersant, emulsifier, and in formulations for personal care products. Its hydrophilic amino alcohol group enhances solubility in water, while the hydrophobic alkyl chains improve compatibility with organic solvents. Bis(2-ethylhexyl)aminoethanol is also recognized for its potential role in enhancing the stability and performance of formulations in industrial and consumer products. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper usage and risk management.
Formula:C18H39NO
InChI:InChI=1S/C18H39NO/c1-5-9-11-17(7-3)15-19(13-14-20)16-18(8-4)12-10-6-2/h17-18,20H,5-16H2,1-4H3
InChI key:InChIKey=FMFWSIARXFCACS-UHFFFAOYSA-N
SMILES:N(CC(CCCC)CC)(CC(CCCC)CC)CCO
Synonyms:- N,N-Di(2-ethylhexyl)aminoethanol
- 2-[Bis(2-ethylhexyl)amino]ethanol
- Ethanol, 2-[bis(2-ethylhexyl)amino]-
- Bis(2-ethylhexyl)aminoethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
