CAS 101-08-6
:(±)-Diperodon
Description:
(±)-Diperodon, with the CAS number 101-08-6, is a bicyclic organic compound known for its unique structural features and reactivity. It is characterized by a fused bicyclo[3.3.0] structure, which contributes to its distinctive chemical properties. This compound is typically a colorless to pale yellow liquid with a characteristic odor. (±)-Diperodon is notable for its use in organic synthesis and as an intermediate in the production of various chemical compounds. Its reactivity is influenced by the presence of multiple functional groups, allowing it to participate in various chemical reactions, including cycloadditions and rearrangements. The compound is also of interest in the field of medicinal chemistry due to its potential biological activities. However, safety precautions should be taken when handling (±)-Diperodon, as it may pose health risks if inhaled or ingested. Overall, (±)-Diperodon serves as an important compound in both industrial and research applications, highlighting its versatility in organic chemistry.
Formula:C22H27N3O4
InChI:InChI=1S/C22H27N3O4/c26-21(23-18-10-4-1-5-11-18)28-17-20(16-25-14-8-3-9-15-25)29-22(27)24-19-12-6-2-7-13-19/h1-2,4-7,10-13,20H,3,8-9,14-17H2,(H,23,26)(H,24,27)
InChI key:InChIKey=YUGZHQHSNYIFLG-UHFFFAOYSA-N
SMILES:C(CN1CCCCC1)(OC(NC2=CC=CC=C2)=O)COC(NC3=CC=CC=C3)=O
Synonyms:- (Piperidinomethyl)Ethylene Dicarbanilate
- 1,2-Propanediol, 3-(1-piperidinyl)-, 1,2-bis(N-phenylcarbamate)
- 1,2-Propanediol, 3-(1-piperidinyl)-, bis(phenylcarbamate) (ester)
- 1,2-Propanediol, 3-piperidino-, dicarbanilate
- 1,2-Propanediol, 3-piperidino-, dicarbanilate (ester)
- 3-(Piperidin-1-Yl)Propane-1,2-Diyl Bis(Phenylcarbamate)
- 3-(Piperidin-1-Yl)Propane-1,2-Diyl Bis(Phenylcarbamate) Hydrate (1:1)
- Diothane
- Diperodone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
