CAS 101-56-4
:Benzenediazonium, 4-(phenylamino)-, chloride (1:1)
Description:
Benzenediazonium, 4-(phenylamino)-, chloride (1:1), commonly referred to as 4-phenylamino-benzenediazonium chloride, is an organic compound characterized by its diazonium functional group, which is a key feature in many synthetic organic reactions. This compound typically appears as a yellow to orange solid and is soluble in water and organic solvents. It is known for its reactivity, particularly in electrophilic aromatic substitution reactions, where it can act as a powerful electrophile due to the presence of the diazonium group. The compound is often used in dye synthesis and as an intermediate in the preparation of various azo compounds. Safety precautions are essential when handling this substance, as diazonium salts can be unstable and potentially hazardous, especially when exposed to heat or light. Additionally, it is important to note that the compound should be handled in a controlled environment to prevent any unwanted reactions or decomposition. Overall, 4-phenylamino-benzenediazonium chloride is a valuable reagent in organic chemistry with significant applications in dye chemistry and synthetic pathways.
Formula:C12H10N3·Cl
InChI:InChI=1S/C12H10N3.ClH/c13-15-12-8-6-11(7-9-12)14-10-4-2-1-3-5-10;/h1-9,14H;1H/q+1;/p-1
InChI key:InChIKey=GREMVPUSQUHWDU-UHFFFAOYSA-M
SMILES:N(C1=CC=C([N+]#N)C=C1)C2=CC=CC=C2.[Cl-]
Synonyms:- p-Anilinobenzenediazonium chloride
- Benzenediazonium, 4-(phenylamino)-, chloride (1:1)
- Diphenylamine-4-diazonium chloride
- Benzenediazonium, 4-(phenylamino)-, chloride
- Benzenediazonium, p-anilino-, chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
