
CAS 101-71-3
:Phenol, 4-(phenylmethyl)-, 1-carbamate
Description:
Phenol, 4-(phenylmethyl)-, 1-carbamate, commonly known as phenylcarbamate, is an organic compound characterized by its phenolic structure combined with a carbamate functional group. It features a phenylmethyl group (benzyl) attached to the para position of the phenolic ring, which contributes to its chemical properties. This compound is typically a white to off-white solid and is soluble in organic solvents, reflecting its hydrophobic characteristics due to the aromatic rings. It exhibits moderate stability under standard conditions but can undergo hydrolysis in the presence of strong acids or bases, leading to the release of phenol and the corresponding amine. Phenylcarbamate is often studied for its potential applications in pharmaceuticals and agrochemicals, as well as its role in various chemical syntheses. Safety considerations include its potential toxicity and the need for proper handling to avoid exposure. Overall, its unique structure and properties make it a subject of interest in both industrial and research settings.
Formula:C14H13NO2
InChI:InChI=1S/C14H13NO2/c15-14(16)17-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9H,10H2,(H2,15,16)
InChI key:InChIKey=ZBJBRUSGEJORQL-UHFFFAOYSA-N
SMILES:C(C1=CC=C(OC(N)=O)C=C1)C2=CC=CC=C2
Synonyms:- Phenol, 4-(phenylmethyl)-, 1-carbamate
- Carbamic acid, α-phenyl-p-tolyl ester
- p-Benzylphenyl carbamate
- p-Cresol, α-phenyl-, carbamate
- Phenol, 4-(phenylmethyl)-, carbamate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Diphenan
CAS:Diphenan is a Chinese chitin-derived compound with potent anticancer activity. It functions as a tumor inhibitor by targeting specific human cancer cells and inducing apoptosis, or programmed cell death. Diphenan has been shown to inhibit the activity of kinase inhibitors, which play a critical role in regulating cell growth and division. In addition, this compound has been demonstrated to have heparin-like properties that can inhibit the growth of cancer cells by interfering with their ability to form blood vessels. Diphenan is excreted in the urine and has a potassium-sparing effect that may be beneficial for patients undergoing chemotherapy. Overall, Diphenan represents a promising new class of anticancer agents with unique mechanisms of action that could potentially lead to improved treatment outcomes for cancer patients.Formula:C14H13NO2Purity:Min. 95%Molecular weight:227.26 g/mol
