
CAS 1010-50-0
:2,3,4,7-Tetramethylbenzothiophene
Description:
2,3,4,7-Tetramethylbenzothiophene is an organic compound characterized by its complex structure, which includes a benzothiophene core substituted with four methyl groups. This compound features a thiophene ring fused to a benzene ring, contributing to its aromatic properties. The presence of multiple methyl groups enhances its hydrophobicity and influences its physical properties, such as boiling and melting points, making it less polar compared to its unsubstituted counterparts. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The compound is of interest in various fields, including organic synthesis and materials science, due to its potential applications in the development of organic semiconductors and as a building block in the synthesis of more complex molecules. Additionally, its unique structure may impart interesting electronic and optical properties, making it a subject of study in the context of organic electronics and photonics. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C12H14S
InChI:InChI=1S/C12H14S/c1-7-5-6-8(2)12-11(7)9(3)10(4)13-12/h5-6H,1-4H3
InChI key:InChIKey=ZMAWYWXCNZDPRJ-UHFFFAOYSA-N
SMILES:CC=1C=2C(=C(C)C=CC2C)SC1C
Synonyms:- 2,3,4,7-Tetramethylbenzothiophene
- 2,3,4,7-Tetramethyl-1-benzothiophene
- Benzo[b]thiophene, 2,3,4,7-tetramethyl-
- 2,3,4,7-Tetramethylbenzo[b]thiophene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
