CAS 1010-55-5

4-Pteridinamine, 7-methyl-, 5-oxide

Description:

4-Pteridinamine, 7-methyl-, 5-oxide, also known by its CAS number 1010-55-5, is a chemical compound that belongs to the class of pteridines, which are bicyclic organic compounds containing a pyrimidine and a pyrazine ring. This substance is characterized by the presence of an amino group at the 4-position and a methyl group at the 7-position of the pteridine ring, along with an oxide functional group at the 5-position. It is typically a crystalline solid and may exhibit solubility in polar solvents. The compound is of interest in various fields, including biochemistry and pharmacology, due to its potential biological activities. Its structural features suggest that it may participate in various chemical reactions, including oxidation and substitution reactions. Additionally, the presence of the amino and methyl groups can influence its reactivity and interaction with biological systems. As with many pteridine derivatives, it may also play a role in the metabolism of folate and related compounds.

Formula: C₇H₇N₅O

InChI: InChI=1S/C7H7N5O/c1-4-2-12(13)5-6(8)9-3-10-7(5)11-4/h2-3H,1H3,(H2,8,9,10,11)

InChI key: InChIKey=NLRZUEWXTBSGPB-UHFFFAOYSA-N

SMILES: O=N=1C2=C(N=C(C)C1)N=CN=C2N

Synonyms:

• 4-Pteridinamine, 7-methyl-, 5-oxide
• Pteridine, 4-amino-7-methyl-, 5-oxide

4-Pteridinamine, 7-methyl-, 5-oxide

CAS: 1010-55-5

Formula: C₇H₇N₅O

Molecular weight: 177.1634

Ref: IN-DA0003GE