
CAS 1010-69-1
:5-Chloro-N-methyl-2-(methylamino)benzamide
Description:
5-Chloro-N-methyl-2-(methylamino)benzamide, with the CAS number 1010-69-1, is an organic compound characterized by its aromatic structure, which includes a benzamide moiety substituted with a chlorine atom and a methylamino group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar organic solvents. The presence of the chloro and methylamino groups contributes to its reactivity and potential biological activity, making it of interest in pharmaceutical research. The compound's molecular structure suggests it may participate in hydrogen bonding due to the amide functional group, influencing its solubility and interaction with biological targets. Additionally, the chlorine substituent can affect the electronic properties of the molecule, potentially impacting its pharmacokinetics and pharmacodynamics. As with many chemical substances, safety data should be consulted to understand its handling, toxicity, and environmental impact. Overall, 5-Chloro-N-methyl-2-(methylamino)benzamide represents a compound with significant potential for further study in medicinal chemistry.
Formula:C9H11ClN2O
InChI:InChI=1S/C9H11ClN2O/c1-11-8-4-3-6(10)5-7(8)9(13)12-2/h3-5,11H,1-2H3,(H,12,13)
InChI key:InChIKey=BMCOSVQERMMXFD-UHFFFAOYSA-N
SMILES:C(NC)(=O)C1=C(NC)C=CC(Cl)=C1
Synonyms:- Benzamide, 5-chloro-N-methyl-2-(methylamino)-
- 5-Chloro-N-methyl-2-(methylamino)benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.