CymitQuimica logo

CAS 101001-59-6

:

1H-Pyrrole-2-carbonitrile,1-ethyl-(9CI)

Description:
1H-Pyrrole-2-carbonitrile, 1-ethyl- (9CI) is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing one nitrogen atom. This compound features a carbonitrile functional group (-C≡N) at the 2-position of the pyrrole ring and an ethyl group (-C2H5) at the 1-position. The presence of the carbonitrile group imparts notable reactivity, making it useful in various synthetic applications, particularly in the field of medicinal chemistry and organic synthesis. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its solubility in organic solvents and relatively low boiling point suggest it can be handled with standard laboratory techniques. Additionally, 1H-Pyrrole-2-carbonitrile, 1-ethyl- may exhibit biological activity, which can be explored for potential pharmaceutical applications. Safety data should be consulted to understand its handling and toxicity, as with any chemical substance.
Formula:C7H8N2
InChI:InChI=1S/C7H8N2/c1-2-9-5-3-4-7(9)6-8/h3-5H,2H2,1H3
InChI key:ZFGBIFTUNFGCQT-UHFFFAOYSA-N
SMILES:CCN1C=CC=C1C#N
Found 2 products.