
CAS 101001-63-2
:1-(1-Methylethyl)-1H-pyrrole-2-carbothioamide
Description:
1-(1-Methylethyl)-1H-pyrrole-2-carbothioamide, identified by its CAS number 101001-63-2, is a chemical compound characterized by its unique structure, which includes a pyrrole ring substituted with a isopropyl group and a carbothioamide functional group. This compound typically exhibits properties associated with both heterocyclic compounds and thioureas, such as potential reactivity in nucleophilic substitution reactions due to the presence of the thiocarbonyl group. It may also display biological activity, making it of interest in medicinal chemistry and drug development. The presence of the isopropyl group can influence its solubility and stability, while the pyrrole moiety may contribute to its electronic properties. As with many organic compounds, its behavior in various solvents and under different conditions can vary significantly, impacting its applications in synthesis and potential therapeutic uses. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper laboratory practices.
Formula:C8H12N2S
InChI:InChI=1S/C8H12N2S/c1-6(2)10-5-3-4-7(10)8(9)11/h3-6H,1-2H3,(H2,9,11)
InChI key:InChIKey=TYSCIPJPUXJQSX-UHFFFAOYSA-N
SMILES:C(N)(=S)C=1N(C(C)C)C=CC1
Synonyms:- 1H-Pyrrole-2-carbothioamide, 1-(1-methylethyl)-
- 1-(1-Methylethyl)-1H-pyrrole-2-carbothioamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.