CAS 101001-67-6

1-(2-methylpropyl)-1H-pyrrole-2-carbothioamide

Description:

1-(2-Methylpropyl)-1H-pyrrole-2-carbothioamide is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. The presence of a carbothioamide functional group indicates that it contains a sulfur atom bonded to a carbonyl carbon, contributing to its reactivity and potential biological activity. The 2-methylpropyl substituent enhances its hydrophobic character, which may influence its solubility and interaction with biological membranes. This compound may exhibit properties typical of thioamides, such as potential antimicrobial or antifungal activity, due to the presence of the sulfur atom. Additionally, the pyrrole moiety is known for its involvement in various biochemical processes and can participate in coordination chemistry. Overall, the unique combination of functional groups in 1-(2-methylpropyl)-1H-pyrrole-2-carbothioamide suggests that it could be of interest in medicinal chemistry and materials science, although specific applications would depend on further research and characterization.

Formula: C₉H₁₄N₂S

InChI: InChI=1/C9H14N2S/c1-7(2)6-11-5-3-4-8(11)9(10)12/h3-5,7H,6H2,1-2H3,(H2,10,12)