CAS 101001-72-3
:{2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-1H-pyrrol-1-yl}acetic acid
Description:
The chemical substance known as {2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-1H-pyrrol-1-yl}acetic acid, with the CAS number 101001-72-3, is a complex organic compound characterized by its unique structural features. It contains a pyrrole ring, which is a five-membered aromatic heterocycle, and a thiazole moiety, contributing to its potential biological activity. The presence of methoxyphenyl groups enhances its lipophilicity and may influence its interaction with biological targets. This compound is likely to exhibit properties such as moderate solubility in organic solvents and potential reactivity due to the carboxylic acid functional group. Its structural complexity suggests possible applications in medicinal chemistry, particularly in the development of pharmaceuticals. The thiazole and pyrrole components may impart specific pharmacological properties, making it a candidate for further investigation in drug discovery. Overall, this compound's unique combination of functional groups and heterocycles positions it as an interesting subject for research in various chemical and biological contexts.
Formula:C23H20N2O4S
InChI:InChI=1/C23H20N2O4S/c1-28-17-9-5-15(6-10-17)21-22(16-7-11-18(29-2)12-8-16)30-23(24-21)19-4-3-13-25(19)14-20(26)27/h3-13H,14H2,1-2H3,(H,26,27)
SMILES:COc1ccc(cc1)c1c(c2ccc(cc2)OC)sc(c2cccn2CC(=O)O)n1
Synonyms:- 1H-pyrrole-1-acetic acid, 2-[4,5-bis(4-methoxyphenyl)-2-thiazolyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1H-Pyrrole-1-aceticacid, 2-[4,5-bis(4-methoxyphenyl)-2-thiazolyl]-
CAS:Formula:C23H20N2O4SMolecular weight:420.48092-(4,5-Bis(4-methoxylphenyl)thiazol-2-yl)pyrrol-1-ylacetic acid
CAS:<p>2-(4,5-Bis(4-methoxylphenyl)thiazol-2-yl)pyrrol-1-ylacetic acid is a potent activator of the transient receptor potential cation channel subfamily V member 1 (TRPV1), which is a member of the TRP family. It also interacts with peptides in the TRPV1 receptor and inhibits ligand binding to this receptor. 2-(4,5-Bis(4-methoxylphenyl)thiazol-2-yl)pyrrol-1-ylacetic acid is used as a research tool in pharmacology, cell biology, and antibody production.</p>Formula:C23H20N2O4SPurity:Min. 95%Molecular weight:420.5 g/molDesethyl KBT-3022
CAS:Desethyl KBT-3022 is an active metabolite of the antiplatelet compound KBT-3022.Formula:C23H20N2O4SPurity:98%Color and Shape:SolidMolecular weight:420.48


