CAS 101002-44-2

4'-ETHYLBIPHENYL-4-CARBOXALDEHYDE

Description:

4'-Ethylbiphenyl-4-carboxaldehyde, with the CAS number 101002-44-2, is an organic compound characterized by its biphenyl structure substituted with an ethyl group and an aldehyde functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its aromatic properties, which can influence its reactivity and interactions in various chemical processes. The presence of the aldehyde group makes it a potential candidate for further chemical transformations, such as oxidation or condensation reactions. Additionally, the ethyl substitution can affect its solubility and volatility, making it relevant in fields such as organic synthesis and materials science. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken due to potential hazards associated with its use.

Formula: C₁₅H₁₄O

InChI: InChI=1/C15H14O/c1-2-12-3-7-14(8-4-12)15-9-5-13(11-16)6-10-15/h3-11H,2H2,1H3

SMILES: CCc1ccc(cc1)c1ccc(cc1)C=O

Synonyms:

• 4'-Ethyl-1,1'-Biphenyl-4-Carboxaldehyde
• 4-(4-Ethylphenyl)Benzaldehyde
• 4'-Ethylbiphenyl-4-Carbaldehyde

4'-ethyl-[1,1'-biphenyl]-4-carbaldehyde

CAS: 101002-44-2

Formula: C₁₅H₁₄O

Purity: 97%

Molecular weight: 210.2711

Ref: IN-DA0003GX

4-(4-Ethylphenyl)benzaldehyde

CAS: 101002-44-2

4-(4-Ethylphenyl)benzaldehyde is a high quality, reagent, complex compound. CAS No. 101002-44-2. It is a useful intermediate and fine chemical that can be used as a versatile building block for the synthesis of speciality chemicals such as research chemicals and reaction components. This chemical is an excellent starting material for the synthesis of useful scaffolds and useful building blocks.

Formula: C₁₅H₁₄O

Purity: Min. 95%

Color and Shape: Solid

Molecular weight: 210.27 g/mol

Ref: 3D-FE67639