CAS 1010073-32-1

4-[3-(1-Methylethyl)phenyl]piperidine

Description:

4-[3-(1-Methylethyl)phenyl]piperidine, identified by its CAS number 1010073-32-1, is an organic compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a phenyl group substituted with an isopropyl group at the para position relative to the nitrogen atom of the piperidine. The presence of the isopropyl group contributes to its hydrophobic characteristics, influencing its solubility and interaction with biological systems. The compound may exhibit properties typical of piperidine derivatives, such as potential psychoactive effects or applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its structural features suggest that it may engage in various chemical reactions, including nucleophilic substitutions and hydrogen bonding, which can affect its reactivity and stability. Additionally, the compound's molecular structure may allow for specific interactions with biological targets, making it of interest in drug design and development. Overall, 4-[3-(1-Methylethyl)phenyl]piperidine represents a unique chemical entity with potential applications in various fields of chemistry and pharmacology.

Formula: C₁₄H₂₁N

InChI: InChI=1S/C14H21N/c1-11(2)13-4-3-5-14(10-13)12-6-8-15-9-7-12/h3-5,10-12,15H,6-9H2,1-2H3

InChI key: InChIKey=XUDUNBWUPFOKIM-UHFFFAOYSA-N

SMILES: C(C)(C)C=1C=C(C=CC1)C2CCNCC2

Synonyms:

• 4-[3-(1-Methylethyl)phenyl]piperidine
• Piperidine, 4-[3-(1-methylethyl)phenyl]-