CAS 1010085-13-8

trans-4-(3-Chloro-2-fluorophenoxy)-1-{[6-(1,3-thiazol-2-ylamino)-2-pyridinyl]methyl}cyclohexanecarboxylic acid

Description:

Trans-4-(3-Chloro-2-fluorophenoxy)-1-{[6-(1,3-thiazol-2-ylamino)-2-pyridinyl]methyl}cyclohexanecarboxylic acid, with CAS number 1010085-13-8, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple functional groups. This compound features a cyclohexanecarboxylic acid moiety, indicating the presence of a carboxylic acid functional group that contributes to its acidity and potential reactivity. The presence of a thiazole ring and a pyridine derivative suggests biological activity, possibly as a pharmaceutical agent. The chlorofluorophenoxy group enhances its lipophilicity, which may influence its absorption and distribution in biological systems. Additionally, the trans configuration implies specific stereochemical properties that can affect its interaction with biological targets. Overall, this compound's unique combination of functional groups and structural features positions it as a candidate for further investigation in medicinal chemistry and drug development.

Formula: C₂₂H₂₁ClFN₃O₃S

InChI: InChI=1S/C22H21ClFN3O3S/c23-16-4-2-5-17(19(16)24)30-15-7-9-22(10-8-15,20(28)29)13-14-3-1-6-18(26-14)27-21-25-11-12-31-21/h1-6,11-12,15H,7-10,13H2,(H,28,29)(H,25,26,27)/t15-,22-

SMILES: c1cc(C[C@@]2(CC[C@@H](CC2)Oc2cccc(c2F)Cl)C(=O)O)nc(c1)Nc1nccs1

Synonyms:

• Mk-5108

MK-5108 (VX-689)

CAS: 1010085-13-8

Formula: C₂₂H₂₁ClFN₃O₃S

Purity: 98%

Color and Shape: Solid

Molecular weight: 461.9368

Ref: IN-DA008TI5

MK-5108

CAS: 1010085-13-8

MK-5108

Purity: ≥98%

Molecular weight: 461.94g/mol

Ref: 54-BUP08549

MK-5108

CAS: 1010085-13-8

MK-5108 (VX-689) is a highly potent and specific Aurora-A kinase inhibitor with an IC50 value of 0.064 nM.

Formula: C₂₂H₂₁ClFN₃O₃S

Purity: 99.22%

Color and Shape: Solid

Molecular weight: 461.94

Ref: TM-T6068

MK 5108

CAS: 1010085-13-8

Inhibitor of Aurora A kinase

Formula: C₂₂H₂₁ClFN₃O₃S

Purity: Min. 95%

Molecular weight: 461.94 g/mol

Ref: 3D-FM103119