CAS 1010097-90-1

Cyclopropanamine, N-(2,2-difluoroethyl)-, hydrochloride (1:1)

Description:

Cyclopropanamine, N-(2,2-difluoroethyl)-, hydrochloride (1:1) is a chemical compound characterized by its cyclopropane structure, which contributes to its unique reactivity and steric properties. The presence of the difluoroethyl group introduces significant electronegativity due to the fluorine atoms, potentially affecting the compound's polarity and solubility in various solvents. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it easier to handle in laboratory settings. This compound may exhibit biological activity, which could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure suggests potential applications in areas such as drug design or as a building block in organic synthesis. However, specific safety and handling guidelines should be followed due to the presence of fluorinated groups, which can pose environmental and health risks. As with any chemical, thorough understanding and assessment of its properties, reactivity, and potential applications are essential for safe and effective use.

Formula: C₅H₉F₂N·ClH

InChI: InChI=1S/C5H9F2N.ClH/c6-5(7)3-8-4-1-2-4;/h4-5,8H,1-3H2;1H

InChI key: InChIKey=UMOOJIWLEQUZLF-UHFFFAOYSA-N

SMILES: N(CC(F)F)C1CC1.Cl

Synonyms:

• Cyclopropanamine, N-(2,2-difluoroethyl)-, hydrochloride (1:1)

N-(2,2-Difluoroethyl)cyclopropanamine hydrochloride

CAS: 1010097-90-1

Versatile small molecule scaffold

Formula: C₅H₁₀ClF₂N

Purity: Min. 95%

Molecular weight: 157.59 g/mol

Ref: 3D-KQB09790