CAS 10101-21-0
:Strontium gluconate
Description:
Strontium gluconate is a chemical compound that consists of strontium, a metallic element, and gluconic acid, an organic acid. It is typically encountered as a white, crystalline powder that is soluble in water, making it suitable for various applications, particularly in dietary supplements and pharmaceuticals. Strontium gluconate is known for its potential benefits in bone health, as strontium is believed to play a role in bone metabolism and may help in the prevention of osteoporosis. The compound is often used as a source of strontium in nutritional formulations. Its molecular formula reflects the presence of strontium ions and gluconate anions, which contribute to its stability and solubility. Additionally, strontium gluconate is generally regarded as safe for consumption when used appropriately, although it is essential to adhere to recommended dosages to avoid potential side effects. As with any supplement, individuals should consult healthcare professionals before starting any new regimen, especially those with underlying health conditions or those taking other medications.
Formula:C6H12O7Sr
InChI:InChI=1S/C6H12O7.Sr/c7-1-2(8)3(9)4(10)5(11)6(12)13;/h2-5,7-11H,1H2,(H,12,13);/t2-,3-,4+,5-;/m1./s1
InChI key:InChIKey=ONFVHBKMJQEVAR-JJKGCWMISA-N
SMILES:[C@H]([C@@H]([C@@H](CO)O)O)([C@H](C(O)=O)O)O.[Sr]
Synonyms:- <span class="text-smallcaps">D</span>-Gluconic acid, strontium salt (2:1)
- Gluconic acid, strontium salt (2:1)
- Strontium 2,3,4,5,6-Pentahydroxyhexanoate
- strontium D-gluconate (1:2)
- D-Gluconic acid, strontium salt (2:1)
- Strontium gluconate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
