CAS 1010102-86-9

1-(4-Amino-6-chloro-1H-indazol-1-yl)ethanone

Description:

1-(4-Amino-6-chloro-1H-indazol-1-yl)ethanone, with the CAS number 1010102-86-9, is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of an amino group and a chloro substituent on the indazole ring contributes to its reactivity and potential biological activity. The ethanone moiety indicates that it contains a carbonyl group adjacent to an ethyl group, which can influence its chemical properties, such as polarity and solubility. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its structural features suggest potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability, solubility in different solvents, and reactivity with other chemical species would be important considerations in both laboratory and industrial settings. Overall, 1-(4-Amino-6-chloro-1H-indazol-1-yl)ethanone represents a versatile structure with implications in chemical research and drug development.

Formula: C₉H₈ClN₃O

InChI: InChI=1S/C9H8ClN3O/c1-5(14)13-9-3-6(10)2-8(11)7(9)4-12-13/h2-4H,11H2,1H3

InChI key: InChIKey=XXWYSAWLGMKPFF-UHFFFAOYSA-N

SMILES: C(C)(=O)N1C=2C(C=N1)=C(N)C=C(Cl)C2

Synonyms:

• Ethanone, 1-(4-amino-6-chloro-1H-indazol-1-yl)-
• 1-(4-Amino-6-chloro-1H-indazol-1-yl)ethanone
• 1-(4-Amino-6-chloroindazol-1-yl)ethanone