
CAS 101012-40-2
:α,α,1-Trimethyl-1H-pyrazole-3-methanol
Description:
α,α,1-Trimethyl-1H-pyrazole-3-methanol, with the CAS number 101012-40-2, is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features three methyl groups attached to the pyrazole ring, contributing to its unique properties, including increased lipophilicity and potential biological activity. The presence of a hydroxymethyl group at the 3-position of the pyrazole enhances its reactivity and solubility in polar solvents. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and agricultural applications. Its structural characteristics suggest potential interactions with biological targets, which could lead to various applications in drug development or as a biochemical tool. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through experimental studies and literature reviews. Overall, α,α,1-Trimethyl-1H-pyrazole-3-methanol represents a versatile compound within the realm of organic chemistry.
Formula:C7H12N2O
InChI:InChI=1S/C7H12N2O/c1-7(2,10)6-4-5-9(3)8-6/h4-5,10H,1-3H3
InChI key:InChIKey=KIICXRAZTXYPBS-UHFFFAOYSA-N
SMILES:C(C)(C)(O)C1=NN(C)C=C1
Synonyms:- 2-(1-Methyl-1H-pyrazol-3-yl)propan-2-ol
- α,α,1-Trimethyl-1H-pyrazole-3-methanol
- Pyrazole-3-methanol, α,α,1-trimethyl-
- 1H-Pyrazole-3-methanol, α,α,1-trimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.