
CAS 101012-80-0
:Phenol, 2,2′-dithiobis[5-(1,1-dimethylethyl)-
Description:
Phenol, 2,2′-dithiobis[5-(1,1-dimethylethyl)-] is an organic compound characterized by the presence of a phenolic structure and two dithiobis groups, which contribute to its unique chemical properties. This compound features bulky tert-butyl groups that enhance its hydrophobicity and steric hindrance, making it less soluble in water but more soluble in organic solvents. The dithiobis moiety introduces potential for redox reactions, allowing the compound to act as an antioxidant or a stabilizer in various chemical processes. Its structure suggests that it may exhibit significant thermal stability and resistance to oxidation, which can be advantageous in industrial applications. Additionally, the presence of multiple functional groups may allow for further chemical modifications, making it versatile in synthetic chemistry. Overall, this compound's characteristics make it of interest in fields such as materials science, polymer chemistry, and potentially in biological applications due to its antioxidant properties.
Formula:C20H26O2S2
InChI:InChI=1S/C20H26O2S2/c1-19(2,3)13-7-9-17(15(21)11-13)23-24-18-10-8-14(12-16(18)22)20(4,5)6/h7-12,21-22H,1-6H3
InChI key:InChIKey=IIODSQVVTNEMIN-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C1=CC(O)=C(SSC2=C(O)C=C(C(C)(C)C)C=C2)C=C1
Synonyms:- Phenol, 2,2′-dithiobis[5-(1,1-dimethylethyl)-
- 2,2′-Dithiobis[5-(1,1-dimethylethyl)phenol]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
