
CAS 1010120-58-7
:N-(5-Bromo-2-chloro-3-pyridinyl)methanesulfonamide
Description:
N-(5-Bromo-2-chloro-3-pyridinyl)methanesulfonamide is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with bromine and chlorine atoms, as well as a methanesulfonamide functional group. This compound is typically a solid at room temperature and is soluble in polar solvents, reflecting its polar sulfonamide group. The presence of halogen substituents can influence its reactivity and biological activity, making it of interest in medicinal chemistry and drug development. The sulfonamide moiety is known for its antibacterial properties, and compounds like this may exhibit potential therapeutic effects. Its molecular structure contributes to its ability to interact with biological targets, which is essential for its application in pharmaceuticals. Safety and handling precautions are necessary due to the presence of halogens, which can pose health risks. Overall, N-(5-Bromo-2-chloro-3-pyridinyl)methanesulfonamide represents a class of compounds that are valuable in research and development within the field of chemistry and pharmacology.
Formula:C6H6BrClN2O2S
InChI:InChI=1S/C6H6BrClN2O2S/c1-13(11,12)10-5-2-4(7)3-9-6(5)8/h2-3,10H,1H3
InChI key:InChIKey=KHEIZFOXMLFVMO-UHFFFAOYSA-N
SMILES:N(S(C)(=O)=O)C1=C(Cl)N=CC(Br)=C1
Synonyms:- Methanesulfonamide, N-(5-bromo-2-chloro-3-pyridinyl)-
- N-(5-Bromo-2-chloro-3-pyridinyl)methanesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.