CAS 101018-99-9
:(4-Bromophenyl)(2,3-dihydro-1,4-benzodioxin-6-yl)methanone
Description:
(4-Bromophenyl)(2,3-dihydro-1,4-benzodioxin-6-yl)methanone, with the CAS number 101018-99-9, is an organic compound characterized by its complex structure that includes a bromophenyl group and a benzodioxin moiety. This compound typically exhibits a white to off-white crystalline appearance. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its unique structural features that may influence biological activity. The presence of the bromine atom can enhance lipophilicity and influence the compound's reactivity and interaction with biological targets. Additionally, the benzodioxin structure contributes to its stability and may affect its solubility in various solvents. As with many organic compounds, it is essential to handle it with care, considering safety protocols, as it may exhibit toxicity or other hazardous properties. Overall, this compound represents a significant interest in synthetic organic chemistry and drug development.
Formula:C15H11BrO3
InChI:InChI=1S/C15H11BrO3/c16-12-4-1-10(2-5-12)15(17)11-3-6-13-14(9-11)19-8-7-18-13/h1-6,9H,7-8H2
InChI key:InChIKey=SGJFGWWIHHLCTG-UHFFFAOYSA-N
SMILES:C(=O)(C=1C=C2C(=CC1)OCCO2)C3=CC=C(Br)C=C3
Synonyms:- 1,4-Benzodioxin, methanone deriv.
- Methanone, (4-Bromophenyl)(2,3-Dihydro-1,4-Benzodioxin-6-Yl)-
- (4-Bromophenyl)(2,3-dihydro-1,4-benzodioxin-6-yl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
