CAS 1010189-79-3

N-(2,2-Difluoroethyl)cyclobutanamine

Description:

N-(2,2-Difluoroethyl)cyclobutanamine is a chemical compound characterized by its unique structure, which includes a cyclobutane ring and a difluoroethyl substituent. The presence of the difluoroethyl group imparts notable properties, such as increased lipophilicity and potential biological activity, making it of interest in medicinal chemistry. The cyclobutane ring contributes to the compound's rigidity, which can influence its reactivity and interaction with biological targets. This compound may exhibit specific stereochemical configurations due to the presence of chiral centers, affecting its pharmacological properties. Additionally, the fluorine atoms can enhance metabolic stability and alter the compound's electronic characteristics. As with many fluorinated compounds, N-(2,2-Difluoroethyl)cyclobutanamine may also exhibit unique solubility and volatility properties. Its synthesis and characterization would typically involve standard organic chemistry techniques, and it may be evaluated for potential applications in pharmaceuticals or agrochemicals. Safety and handling precautions are essential, as with any chemical substance, particularly those with potential biological activity.

Formula: C₆H₁₁F₂N

InChI: InChI=1S/C6H11F2N/c7-6(8)4-9-5-2-1-3-5/h5-6,9H,1-4H2

InChI key: InChIKey=GZIJIZQWFALWOR-UHFFFAOYSA-N

SMILES: N(CC(F)F)C1CCC1

Synonyms:

• N-(2,2-Difluoroethyl)cyclobutanamine
• Cyclobutanamine, N-(2,2-difluoroethyl)-