
CAS 10102-03-1
:Nitrogen oxide (N2O5)
Description:
Nitrogen pentoxide (N2O5) is a colorless, crystalline solid that serves as a significant nitrogen oxide compound. It is known for its strong oxidizing properties and is primarily used in the synthesis of nitric acid and other nitrogen-containing compounds. N2O5 is highly soluble in organic solvents and reacts vigorously with water, forming nitric acid. The compound is stable at low temperatures but can decompose at elevated temperatures, releasing nitrogen dioxide (NO2) and oxygen (O2). Its molecular structure consists of a dimer of nitrogen dioxide, and it exhibits a planar geometry. Due to its oxidizing nature, N2O5 can pose hazards, including potential reactions with flammable materials. In terms of safety, it is classified as a toxic and corrosive substance, necessitating careful handling and storage. Overall, nitrogen pentoxide plays a crucial role in various chemical processes, particularly in the production of fertilizers and explosives, while also being a subject of study in atmospheric chemistry due to its role in nitrogen cycling.
Formula:N2O5
InChI:InChI=1S/N2O5/c3-1(4)7-2(5)6
InChI key:InChIKey=ZWWCURLKEXEFQT-UHFFFAOYSA-N
SMILES:O(N(=O)=O)N(=O)=O
Synonyms:- Dinitrogen pentoxide
- Nitryl nitrate
- Nitrogen oxide (N2O5)
- Nitrogen pentoxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
