CAS 10102-95-1
:1,3-Dimethyl-1H-indol-5-ol
Description:
1,3-Dimethyl-1H-indol-5-ol, with the CAS number 10102-95-1, is an organic compound belonging to the indole family, characterized by a bicyclic structure that includes a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring. This compound features two methyl groups attached to the nitrogen atom at the 1 and 3 positions, and a hydroxyl group (-OH) at the 5 position, contributing to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit solubility in organic solvents, depending on the specific conditions. The presence of the hydroxyl group suggests that it may participate in hydrogen bonding, influencing its interactions with other molecules. 1,3-Dimethyl-1H-indol-5-ol may be of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in pharmaceuticals and as a precursor in organic synthesis. Its specific properties, such as melting point, boiling point, and spectral characteristics, would require further investigation through experimental methods.
Formula:C10H11NO
InChI:InChI=1S/C10H11NO/c1-7-6-11(2)10-4-3-8(12)5-9(7)10/h3-6,12H,1-2H3
InChI key:InChIKey=YIHBZFHOBSCEFD-UHFFFAOYSA-N
SMILES:CC=1C=2C(N(C)C1)=CC=C(O)C2
Synonyms:- 1H-Indol-5-ol, 1,3-dimethyl-
- Indol-5-ol, 1,3-dimethyl-
- 1,3-Dimethyl-1H-indol-5-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.