CAS 101020-76-2
:N-(8-hydroxy-9H-fluoren-2-yl)acetamide
Description:
N-(8-hydroxy-9H-fluoren-2-yl)acetamide, with the CAS number 101020-76-2, is an organic compound characterized by its unique structural features, which include a fluorenyl moiety and an acetamide functional group. This compound typically exhibits properties associated with both aromatic and amide functionalities, contributing to its potential applications in various fields, including pharmaceuticals and materials science. The presence of the hydroxyl group enhances its solubility in polar solvents and may also impart hydrogen bonding capabilities, influencing its reactivity and interaction with biological systems. Additionally, the fluorenyl structure can provide photophysical properties, making it of interest in studies related to fluorescence and photochemistry. Its synthesis often involves straightforward organic reactions, and it may serve as a precursor or intermediate in the development of more complex molecules. Overall, N-(8-hydroxy-9H-fluoren-2-yl)acetamide is a compound of interest due to its distinctive chemical characteristics and potential utility in various applications.
Formula:C15H13NO2
InChI:InChI=1/C15H13NO2/c1-9(17)16-11-5-6-12-10(7-11)8-14-13(12)3-2-4-15(14)18/h2-7,18H,8H2,1H3,(H,16,17)
SMILES:CC(=Nc1ccc2c(c1)Cc1c2cccc1O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-(8-Hydroxy-9H-fluoren-2-yl)-acetamide
CAS:Controlled ProductFormula:C15H13NO2Color and Shape:NeatMolecular weight:239.269
