CAS 10103-06-7
:2 3-DIMETHOXYNAPHTHALENE 97
Description:
2,3-Dimethoxynaphthalene is an organic compound belonging to the naphthalene family, characterized by the presence of two methoxy (-OCH3) groups attached to the naphthalene ring at the 2 and 3 positions. This compound typically appears as a white to light yellow crystalline solid and is known for its aromatic properties. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic naphthalene structure. 2,3-Dimethoxynaphthalene is often used in organic synthesis and as an intermediate in the production of various chemical compounds. Its chemical behavior is influenced by the electron-donating nature of the methoxy groups, which can affect reactivity in electrophilic aromatic substitution reactions. Additionally, this compound may exhibit interesting physical properties, such as melting and boiling points, which are relevant for its applications in research and industry. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C12H12O2
InChI:InChI=1/C12H12O2/c1-13-11-7-9-5-3-4-6-10(9)8-12(11)14-2/h3-8H,1-2H3
SMILES:COc1cc2ccccc2cc1OC
Synonyms:- 2,3-Dimethoxynaphthalene
- Naphthalene, 2,3-Dimethoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Naphthalene, 2,3-dimethoxy-
CAS:Formula:C12H12O2Purity:98%Color and Shape:SolidMolecular weight:188.22252,3-Dimethoxynaphthalene
CAS:Formula:C12H12O2Purity:98%Color and Shape:Liquid, No data available.Molecular weight:188.2262,3-Dimethoxynaphthalene
CAS:2,3-Dimethoxynaphthalene is a crystalline solid with a molecular weight of 170.24 g/mol. It has a melting point of 150 °C and a boiling point of 313 °C, and it is soluble in organic solvents such as chloroform and ether. 2,3-Dimethoxynaphthalene is an electron donor that can coordinate to metals through sulfur atoms in sulfonated form. The crystal structure consists of alternating double bonds and single bonds, forming a hexagonal closed packed structure. 2,3-Dimethoxynaphthalene has been shown to be luminescent in the visible region of the electromagnetic spectrum due to its ability to emit light when excited by an external source.
Formula:C12H12O2Purity:Min. 95%Molecular weight:188.22 g/mol



