CAS 10103-15-8

Benzenesulfonamide, 4-amino-, sodium salt (1:1)

Description:

Benzenesulfonamide, 4-amino-, sodium salt (1:1) is an organic compound characterized by the presence of a sulfonamide functional group attached to a benzene ring, along with an amino group at the para position. This compound is typically a white to off-white solid that is soluble in water due to the presence of the sodium salt, which enhances its solubility compared to its parent sulfonamide. It exhibits properties typical of sulfonamides, including antibacterial activity, making it relevant in pharmaceutical applications. The compound can participate in various chemical reactions, such as nucleophilic substitutions, due to the reactivity of the amino group. Its structure allows for potential interactions with biological systems, which is significant in medicinal chemistry. Additionally, it may be used in research settings to study sulfonamide derivatives and their effects. Safety data should be consulted for handling and usage, as with all chemical substances, to ensure proper precautions are taken.

Formula: C₆H₈N₂O₂S·Na

InChI: InChI=1S/C6H8N2O2S.Na/c7-5-1-3-6(4-2-5)11(8,9)10;/h1-4H,7H2,(H2,8,9,10);

InChI key: InChIKey=IQIXOVZKIWONBZ-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C1=CC=C(N)C=C1.[Na]

Synonyms:

• Benzenesulfonamide, 4-amino-, sodium salt (1:1)
• Benzenesulfonamide, 4-amino-, monosodium salt
• Sulfanilamide, monosodium salt
• Sodium, sulfanilamido-
• Sulfanilamide sodium